C16H13F2N3O4S — CID 9238081
(2R)-2-(4-cyanophenoxy)-N'-(2,5-difluorophenyl)sulfonylpropanehydrazide (PubChem CID 9238081) has the molecular formula C16H13F2N3O4S and a molecular weight of 381.36 g/mol. Its IUPAC name is (2R)-2-(4-cyanophenoxy)-N'-(2,5-difluorophenyl)sulfonylpropanehydrazide.
| Compound Name | (2R)-2-(4-cyanophenoxy)-N'-(2,5-difluorophenyl)sulfonylpropanehydrazide |
|---|---|
| PubChem CID | 9238081 |
| Molecular Formula | C16H13F2N3O4S |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | (2R)-2-(4-cyanophenoxy)-N'-(2,5-difluorophenyl)sulfonylpropanehydrazide |
| SMILES | C[C@@H](Oc1ccc(C#N)cc1)C(=O)NNS(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C16H13F2N3O4S/c1-10(25-13-5-2-11(9-19)3-6-13)16(22)20-21-26(23,24)15-8-12(17)4-7-14(15)18/h2-8,10,21H,1H3,(H,20,22)/t10-/m1/s1 |
| InChIKey | ZZEQUKMJYGRIHU-SNVBAGLBSA-N |
| XLogP | 1.61 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|