C18H18FN2O6S- — CID 9238868
3-[[[(2S)-2-(4-fluorophenoxy)propanoyl]amino]sulfamoyl]-4,5-dimethylbenzoate (PubChem CID 9238868) has the molecular formula C18H18FN2O6S- and a molecular weight of 409.42 g/mol. Its IUPAC name is 3-[[[(2S)-2-(4-fluorophenoxy)propanoyl]amino]sulfamoyl]-4,5-dimethylbenzoate.
| Compound Name | 3-[[[(2S)-2-(4-fluorophenoxy)propanoyl]amino]sulfamoyl]-4,5-dimethylbenzoate |
|---|---|
| PubChem CID | 9238868 |
| Molecular Formula | C18H18FN2O6S- |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 3-[[[(2S)-2-(4-fluorophenoxy)propanoyl]amino]sulfamoyl]-4,5-dimethylbenzoate |
| SMILES | Cc1cc(C(=O)[O-])cc(S(=O)(=O)NNC(=O)[C@H](C)Oc2ccc(F)cc2)c1C |
| InChI | InChI=1S/C18H19FN2O6S/c1-10-8-13(18(23)24)9-16(11(10)2)28(25,26)21-20-17(22)12(3)27-15-6-4-14(19)5-7-15/h4-9,12,21H,1-3H3,(H,20,22)(H,23,24)/p-1/t12-/m0/s1 |
| InChIKey | QHXDHOCDPHRFGC-LBPRGKRZSA-M |
| XLogP | 0.58 |
| TPSA | 124.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|