C19H22BrN3O5S — CID 55364613
5-[[2-(3-bromophenoxy)propanoylamino]carbamoyl]-N,2,3-trimethylbenzenesulfonamide (PubChem CID 55364613) has the molecular formula C19H22BrN3O5S and a molecular weight of 484.37 g/mol. Its IUPAC name is 5-[[2-(3-bromophenoxy)propanoylamino]carbamoyl]-N,2,3-trimethylbenzenesulfonamide.
| Compound Name | 5-[[2-(3-bromophenoxy)propanoylamino]carbamoyl]-N,2,3-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 55364613 |
| Molecular Formula | C19H22BrN3O5S |
| Molecular Weight | 484.37 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | 5-[[2-(3-bromophenoxy)propanoylamino]carbamoyl]-N,2,3-trimethylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)NNC(=O)C(C)Oc2cccc(Br)c2)cc(C)c1C |
| InChI | InChI=1S/C19H22BrN3O5S/c1-11-8-14(9-17(12(11)2)29(26,27)21-4)19(25)23-22-18(24)13(3)28-16-7-5-6-15(20)10-16/h5-10,13,21H,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | DTCREOMIJOWSBF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|