C20H21BrN2O7 — CID 55788990
methyl 2-[4-[[2-(3-bromophenoxy)propanoylamino]carbamoyl]-2-methoxyphenoxy]acetate (PubChem CID 55788990) has the molecular formula C20H21BrN2O7 and a molecular weight of 481.30 g/mol. Its IUPAC name is methyl 2-[4-[[2-(3-bromophenoxy)propanoylamino]carbamoyl]-2-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[[2-(3-bromophenoxy)propanoylamino]carbamoyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 55788990 |
| Molecular Formula | C20H21BrN2O7 |
| Molecular Weight | 481.30 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | methyl 2-[4-[[2-(3-bromophenoxy)propanoylamino]carbamoyl]-2-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1ccc(C(=O)NNC(=O)C(C)Oc2cccc(Br)c2)cc1OC |
| InChI | InChI=1S/C20H21BrN2O7/c1-12(30-15-6-4-5-14(21)10-15)19(25)22-23-20(26)13-7-8-16(17(9-13)27-2)29-11-18(24)28-3/h4-10,12H,11H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | GHMYYMUUPPTZCA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|