C16H13BrF2N2O3 — CID 51192759
N'-[2-(3-bromophenoxy)propanoyl]-3,4-difluorobenzohydrazide (PubChem CID 51192759) has the molecular formula C16H13BrF2N2O3 and a molecular weight of 399.19 g/mol. Its IUPAC name is N'-[2-(3-bromophenoxy)propanoyl]-3,4-difluorobenzohydrazide.
| Compound Name | N'-[2-(3-bromophenoxy)propanoyl]-3,4-difluorobenzohydrazide |
|---|---|
| PubChem CID | 51192759 |
| Molecular Formula | C16H13BrF2N2O3 |
| Molecular Weight | 399.19 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | N'-[2-(3-bromophenoxy)propanoyl]-3,4-difluorobenzohydrazide |
| SMILES | CC(Oc1cccc(Br)c1)C(=O)NNC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H13BrF2N2O3/c1-9(24-12-4-2-3-11(17)8-12)15(22)20-21-16(23)10-5-6-13(18)14(19)7-10/h2-9H,1H3,(H,20,22)(H,21,23) |
| InChIKey | ZUBCUWOEXWFEFQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.19 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|