C12H12ClNO3S — CID 166403313
N-[2-(4-chlorophenyl)sulfonylethyl]but-2-ynamide (PubChem CID 166403313) has the molecular formula C12H12ClNO3S and a molecular weight of 285.75 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfonylethyl]but-2-ynamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfonylethyl]but-2-ynamide |
|---|---|
| PubChem CID | 166403313 |
| Molecular Formula | C12H12ClNO3S |
| Molecular Weight | 285.75 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfonylethyl]but-2-ynamide |
| SMILES | CC#CC(=O)NCCS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H12ClNO3S/c1-2-3-12(15)14-8-9-18(16,17)11-6-4-10(13)5-7-11/h4-7H,8-9H2,1H3,(H,14,15) |
| InChIKey | XJNXRTLRLRLUFY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.75 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|