C13H21N3O2S — CID 111108985
2-[2-(4-tert-butylphenyl)sulfonylethyl]guanidine (PubChem CID 111108985) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenyl)sulfonylethyl]guanidine.
| Compound Name | 2-[2-(4-tert-butylphenyl)sulfonylethyl]guanidine |
|---|---|
| PubChem CID | 111108985 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-[2-(4-tert-butylphenyl)sulfonylethyl]guanidine |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)CCN=C(N)N)cc1 |
| InChI | InChI=1S/C13H21N3O2S/c1-13(2,3)10-4-6-11(7-5-10)19(17,18)9-8-16-12(14)15/h4-7H,8-9H2,1-3H3,(H4,14,15,16) |
| InChIKey | KSKCDELNAUOURF-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|