C13H20ClN3O2S — CID 119118963
1-tert-butyl-2-[2-(4-chlorophenyl)sulfonylethyl]guanidine (PubChem CID 119118963) has the molecular formula C13H20ClN3O2S and a molecular weight of 317.84 g/mol. Its IUPAC name is 1-tert-butyl-2-[2-(4-chlorophenyl)sulfonylethyl]guanidine.
| Compound Name | 1-tert-butyl-2-[2-(4-chlorophenyl)sulfonylethyl]guanidine |
|---|---|
| PubChem CID | 119118963 |
| Molecular Formula | C13H20ClN3O2S |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 1-tert-butyl-2-[2-(4-chlorophenyl)sulfonylethyl]guanidine |
| SMILES | CC(C)(C)N/C(N)=N/CCS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H20ClN3O2S/c1-13(2,3)17-12(15)16-8-9-20(18,19)11-6-4-10(14)5-7-11/h4-7H,8-9H2,1-3H3,(H3,15,16,17) |
| InChIKey | WCWSEYLMSLMQDI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|