C18H20ClN3O3S — CID 119140818
2-[2-(4-chlorophenyl)sulfonylethyl]-1-(3,4-dihydro-2H-chromen-4-yl)guanidine (PubChem CID 119140818) has the molecular formula C18H20ClN3O3S and a molecular weight of 393.90 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)sulfonylethyl]-1-(3,4-dihydro-2H-chromen-4-yl)guanidine.
| Compound Name | 2-[2-(4-chlorophenyl)sulfonylethyl]-1-(3,4-dihydro-2H-chromen-4-yl)guanidine |
|---|---|
| PubChem CID | 119140818 |
| Molecular Formula | C18H20ClN3O3S |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 2-[2-(4-chlorophenyl)sulfonylethyl]-1-(3,4-dihydro-2H-chromen-4-yl)guanidine |
| SMILES | N/C(=N\CCS(=O)(=O)c1ccc(Cl)cc1)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C18H20ClN3O3S/c19-13-5-7-14(8-6-13)26(23,24)12-10-21-18(20)22-16-9-11-25-17-4-2-1-3-15(16)17/h1-8,16H,9-12H2,(H3,20,21,22) |
| InChIKey | RNVFMLZDGXSXEN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|