C17H21BrIN3O2S — CID 111807871
2-[2-(4-bromophenyl)sulfonylethyl]-1-(3,4-dimethylphenyl)guanidine;hydroiodide (PubChem CID 111807871) has the molecular formula C17H21BrIN3O2S and a molecular weight of 538.25 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)sulfonylethyl]-1-(3,4-dimethylphenyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(4-bromophenyl)sulfonylethyl]-1-(3,4-dimethylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111807871 |
| Molecular Formula | C17H21BrIN3O2S |
| Molecular Weight | 538.25 g/mol |
| Exact Mass | 536.96 |
| IUPAC Name | 2-[2-(4-bromophenyl)sulfonylethyl]-1-(3,4-dimethylphenyl)guanidine;hydroiodide |
| SMILES | Cc1ccc(N/C(N)=N/CCS(=O)(=O)c2ccc(Br)cc2)cc1C.I |
| InChI | InChI=1S/C17H20BrN3O2S.HI/c1-12-3-6-15(11-13(12)2)21-17(19)20-9-10-24(22,23)16-7-4-14(18)5-8-16;/h3-8,11H,9-10H2,1-2H3,(H3,19,20,21);1H |
| InChIKey | ZIOYKPXWCHUXLY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.25 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|