C14H21N3O2S — CID 122099318
2-(2-cyclopropylsulfonylethyl)-1-(3,4-dimethylphenyl)guanidine (PubChem CID 122099318) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is 2-(2-cyclopropylsulfonylethyl)-1-(3,4-dimethylphenyl)guanidine.
| Compound Name | 2-(2-cyclopropylsulfonylethyl)-1-(3,4-dimethylphenyl)guanidine |
|---|---|
| PubChem CID | 122099318 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2-(2-cyclopropylsulfonylethyl)-1-(3,4-dimethylphenyl)guanidine |
| SMILES | Cc1ccc(N/C(N)=N/CCS(=O)(=O)C2CC2)cc1C |
| InChI | InChI=1S/C14H21N3O2S/c1-10-3-4-12(9-11(10)2)17-14(15)16-7-8-20(18,19)13-5-6-13/h3-4,9,13H,5-8H2,1-2H3,(H3,15,16,17) |
| InChIKey | VZUUGSDLYXMQKJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|