C16H25N3O2S — CID 122099393
1-(3,4-dimethylphenyl)-2-[[1-(methylsulfonylmethyl)cyclobutyl]methyl]guanidine (PubChem CID 122099393) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-[[1-(methylsulfonylmethyl)cyclobutyl]methyl]guanidine.
| Compound Name | 1-(3,4-dimethylphenyl)-2-[[1-(methylsulfonylmethyl)cyclobutyl]methyl]guanidine |
|---|---|
| PubChem CID | 122099393 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-[[1-(methylsulfonylmethyl)cyclobutyl]methyl]guanidine |
| SMILES | Cc1ccc(N/C(N)=N/CC2(CS(C)(=O)=O)CCC2)cc1C |
| InChI | InChI=1S/C16H25N3O2S/c1-12-5-6-14(9-13(12)2)19-15(17)18-10-16(7-4-8-16)11-22(3,20)21/h5-6,9H,4,7-8,10-11H2,1-3H3,(H3,17,18,19) |
| InChIKey | INJAPAHYBRGMGY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|