C14H19F2N3O2S — CID 122099377
1-(2,5-difluorophenyl)-2-[[1-(methylsulfonylmethyl)cyclobutyl]methyl]guanidine (PubChem CID 122099377) has the molecular formula C14H19F2N3O2S and a molecular weight of 331.39 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-[[1-(methylsulfonylmethyl)cyclobutyl]methyl]guanidine.
| Compound Name | 1-(2,5-difluorophenyl)-2-[[1-(methylsulfonylmethyl)cyclobutyl]methyl]guanidine |
|---|---|
| PubChem CID | 122099377 |
| Molecular Formula | C14H19F2N3O2S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-[[1-(methylsulfonylmethyl)cyclobutyl]methyl]guanidine |
| SMILES | CS(=O)(=O)CC1(C/N=C(\N)Nc2cc(F)ccc2F)CCC1 |
| InChI | InChI=1S/C14H19F2N3O2S/c1-22(20,21)9-14(5-2-6-14)8-18-13(17)19-12-7-10(15)3-4-11(12)16/h3-4,7H,2,5-6,8-9H2,1H3,(H3,17,18,19) |
| InChIKey | LWEHXTMXMLKIHQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|