C14H18F2N6 — CID 122098759
2-[(3-tert-butyl-1H-1,2,4-triazol-5-yl)methyl]-1-(2,5-difluorophenyl)guanidine (PubChem CID 122098759) has the molecular formula C14H18F2N6 and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-[(3-tert-butyl-1H-1,2,4-triazol-5-yl)methyl]-1-(2,5-difluorophenyl)guanidine.
| Compound Name | 2-[(3-tert-butyl-1H-1,2,4-triazol-5-yl)methyl]-1-(2,5-difluorophenyl)guanidine |
|---|---|
| PubChem CID | 122098759 |
| Molecular Formula | C14H18F2N6 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-[(3-tert-butyl-1H-1,2,4-triazol-5-yl)methyl]-1-(2,5-difluorophenyl)guanidine |
| SMILES | CC(C)(C)c1n[nH]c(C/N=C(\N)Nc2cc(F)ccc2F)n1 |
| InChI | InChI=1S/C14H18F2N6/c1-14(2,3)12-20-11(21-22-12)7-18-13(17)19-10-6-8(15)4-5-9(10)16/h4-6H,7H2,1-3H3,(H3,17,18,19)(H,20,21,22) |
| InChIKey | WQFHPYNACCURTB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|