C15H28N6 — CID 122098753
2-[(3-tert-butyl-1H-1,2,4-triazol-5-yl)methyl]-1-cycloheptylguanidine (PubChem CID 122098753) has the molecular formula C15H28N6 and a molecular weight of 292.43 g/mol. Its IUPAC name is 2-[(3-tert-butyl-1H-1,2,4-triazol-5-yl)methyl]-1-cycloheptylguanidine.
| Compound Name | 2-[(3-tert-butyl-1H-1,2,4-triazol-5-yl)methyl]-1-cycloheptylguanidine |
|---|---|
| PubChem CID | 122098753 |
| Molecular Formula | C15H28N6 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 2-[(3-tert-butyl-1H-1,2,4-triazol-5-yl)methyl]-1-cycloheptylguanidine |
| SMILES | CC(C)(C)c1n[nH]c(C/N=C(\N)NC2CCCCCC2)n1 |
| InChI | InChI=1S/C15H28N6/c1-15(2,3)13-19-12(20-21-13)10-17-14(16)18-11-8-6-4-5-7-9-11/h11H,4-10H2,1-3H3,(H3,16,17,18)(H,19,20,21) |
| InChIKey | RBJMJWIOOIVRDT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|