C18H25IN4O2S — CID 111062380
2-[2-(benzylsulfamoyl)ethyl]-1-(3,4-dimethylphenyl)guanidine;hydroiodide (PubChem CID 111062380) has the molecular formula C18H25IN4O2S and a molecular weight of 488.40 g/mol. Its IUPAC name is 2-[2-(benzylsulfamoyl)ethyl]-1-(3,4-dimethylphenyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(benzylsulfamoyl)ethyl]-1-(3,4-dimethylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111062380 |
| Molecular Formula | C18H25IN4O2S |
| Molecular Weight | 488.40 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | 2-[2-(benzylsulfamoyl)ethyl]-1-(3,4-dimethylphenyl)guanidine;hydroiodide |
| SMILES | Cc1ccc(N/C(N)=N/CCS(=O)(=O)NCc2ccccc2)cc1C.I |
| InChI | InChI=1S/C18H24N4O2S.HI/c1-14-8-9-17(12-15(14)2)22-18(19)20-10-11-25(23,24)21-13-16-6-4-3-5-7-16;/h3-9,12,21H,10-11,13H2,1-2H3,(H3,19,20,22);1H |
| InChIKey | QNFPJPKKNHJWFG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|