C14H24N4O2S — CID 111062383
2-[2-(benzylsulfamoyl)ethyl]-1,1-diethylguanidine (PubChem CID 111062383) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is 2-[2-(benzylsulfamoyl)ethyl]-1,1-diethylguanidine.
| Compound Name | 2-[2-(benzylsulfamoyl)ethyl]-1,1-diethylguanidine |
|---|---|
| PubChem CID | 111062383 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-[2-(benzylsulfamoyl)ethyl]-1,1-diethylguanidine |
| SMILES | CCN(CC)/C(N)=N/CCS(=O)(=O)NCc1ccccc1 |
| InChI | InChI=1S/C14H24N4O2S/c1-3-18(4-2)14(15)16-10-11-21(19,20)17-12-13-8-6-5-7-9-13/h5-9,17H,3-4,10-12H2,1-2H3,(H2,15,16) |
| InChIKey | LKQZAFUAKRNCFD-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|