C14H24N4O2S — CID 111062363
1-[2-(benzylsulfamoyl)ethyl]-2-butylguanidine (PubChem CID 111062363) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is 1-[2-(benzylsulfamoyl)ethyl]-2-butylguanidine.
| Compound Name | 1-[2-(benzylsulfamoyl)ethyl]-2-butylguanidine |
|---|---|
| PubChem CID | 111062363 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-[2-(benzylsulfamoyl)ethyl]-2-butylguanidine |
| SMILES | CCCC/N=C(\N)NCCS(=O)(=O)NCc1ccccc1 |
| InChI | InChI=1S/C14H24N4O2S/c1-2-3-9-16-14(15)17-10-11-21(19,20)18-12-13-7-5-4-6-8-13/h4-8,18H,2-3,9-12H2,1H3,(H3,15,16,17) |
| InChIKey | SJKKCEKZKMWZMN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|