C14H25IN4O2S — CID 111062382
2-[2-(benzylsulfamoyl)ethyl]-1,1-diethylguanidine;hydroiodide (PubChem CID 111062382) has the molecular formula C14H25IN4O2S and a molecular weight of 440.35 g/mol. Its IUPAC name is 2-[2-(benzylsulfamoyl)ethyl]-1,1-diethylguanidine;hydroiodide.
| Compound Name | 2-[2-(benzylsulfamoyl)ethyl]-1,1-diethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111062382 |
| Molecular Formula | C14H25IN4O2S |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 2-[2-(benzylsulfamoyl)ethyl]-1,1-diethylguanidine;hydroiodide |
| SMILES | CCN(CC)/C(N)=N/CCS(=O)(=O)NCc1ccccc1.I |
| InChI | InChI=1S/C14H24N4O2S.HI/c1-3-18(4-2)14(15)16-10-11-21(19,20)17-12-13-8-6-5-7-9-13;/h5-9,17H,3-4,10-12H2,1-2H3,(H2,15,16);1H |
| InChIKey | QHBMSBVZLYHMRK-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|