C18H22BrIN4O — CID 111075534
N-[2-[[amino-(3,4-dimethylanilino)methylidene]amino]ethyl]-4-bromobenzamide;hydroiodide (PubChem CID 111075534) has the molecular formula C18H22BrIN4O and a molecular weight of 517.21 g/mol. Its IUPAC name is N-[2-[[amino-(3,4-dimethylanilino)methylidene]amino]ethyl]-4-bromobenzamide;hydroiodide.
| Compound Name | N-[2-[[amino-(3,4-dimethylanilino)methylidene]amino]ethyl]-4-bromobenzamide;hydroiodide |
|---|---|
| PubChem CID | 111075534 |
| Molecular Formula | C18H22BrIN4O |
| Molecular Weight | 517.21 g/mol |
| Exact Mass | 516.00 |
| IUPAC Name | N-[2-[[amino-(3,4-dimethylanilino)methylidene]amino]ethyl]-4-bromobenzamide;hydroiodide |
| SMILES | Cc1ccc(N/C(N)=N/CCNC(=O)c2ccc(Br)cc2)cc1C.I |
| InChI | InChI=1S/C18H21BrN4O.HI/c1-12-3-8-16(11-13(12)2)23-18(20)22-10-9-21-17(24)14-4-6-15(19)7-5-14;/h3-8,11H,9-10H2,1-2H3,(H,21,24)(H3,20,22,23);1H |
| InChIKey | VEOQEXGBZUUUPX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.21 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|