C20H23BrN4O3 — CID 111094041
N-[3-[[amino-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methylidene]amino]propyl]-4-bromobenzamide (PubChem CID 111094041) has the molecular formula C20H23BrN4O3 and a molecular weight of 447.33 g/mol. Its IUPAC name is N-[3-[[amino-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methylidene]amino]propyl]-4-bromobenzamide.
| Compound Name | N-[3-[[amino-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methylidene]amino]propyl]-4-bromobenzamide |
|---|---|
| PubChem CID | 111094041 |
| Molecular Formula | C20H23BrN4O3 |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | N-[3-[[amino-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)methylidene]amino]propyl]-4-bromobenzamide |
| SMILES | N/C(=N\CCCNC(=O)c1ccc(Br)cc1)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C20H23BrN4O3/c21-15-5-3-14(4-6-15)19(26)23-9-1-10-24-20(22)25-16-7-8-17-18(13-16)28-12-2-11-27-17/h3-8,13H,1-2,9-12H2,(H,23,26)(H3,22,24,25) |
| InChIKey | IREBMPRJUDXNOX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|