C18H20BrFIN3O2 — CID 111077844
2-[2-(5-bromo-2-fluorophenyl)ethyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine;hydroiodide (PubChem CID 111077844) has the molecular formula C18H20BrFIN3O2 and a molecular weight of 536.18 g/mol. Its IUPAC name is 2-[2-(5-bromo-2-fluorophenyl)ethyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine;hydroiodide.
| Compound Name | 2-[2-(5-bromo-2-fluorophenyl)ethyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111077844 |
| Molecular Formula | C18H20BrFIN3O2 |
| Molecular Weight | 536.18 g/mol |
| Exact Mass | 534.98 |
| IUPAC Name | 2-[2-(5-bromo-2-fluorophenyl)ethyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCc1cc(Br)ccc1F)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C18H19BrFN3O2.HI/c19-13-2-4-15(20)12(10-13)6-7-22-18(21)23-14-3-5-16-17(11-14)25-9-1-8-24-16;/h2-5,10-11H,1,6-9H2,(H3,21,22,23);1H |
| InChIKey | YKSGMQJUQQYUJZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.18 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|