C20H24ClN3O3 — CID 109467897
2-[2-(5-chloro-2-ethoxyphenyl)ethyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine (PubChem CID 109467897) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is 2-[2-(5-chloro-2-ethoxyphenyl)ethyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine.
| Compound Name | 2-[2-(5-chloro-2-ethoxyphenyl)ethyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine |
|---|---|
| PubChem CID | 109467897 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 2-[2-(5-chloro-2-ethoxyphenyl)ethyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine |
| SMILES | CCOc1ccc(Cl)cc1CC/N=C(\N)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C20H24ClN3O3/c1-2-25-17-6-4-15(21)12-14(17)8-9-23-20(22)24-16-5-7-18-19(13-16)27-11-3-10-26-18/h4-7,12-13H,2-3,8-11H2,1H3,(H3,22,23,24) |
| InChIKey | JYIMDBGVCOGCBI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|