C11H17ClIN3O — CID 109467659
2-[2-(5-chloro-2-ethoxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 109467659) has the molecular formula C11H17ClIN3O and a molecular weight of 369.63 g/mol. Its IUPAC name is 2-[2-(5-chloro-2-ethoxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(5-chloro-2-ethoxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109467659 |
| Molecular Formula | C11H17ClIN3O |
| Molecular Weight | 369.63 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 2-[2-(5-chloro-2-ethoxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCOc1ccc(Cl)cc1CCN=C(N)N.I |
| InChI | InChI=1S/C11H16ClN3O.HI/c1-2-16-10-4-3-9(12)7-8(10)5-6-15-11(13)14;/h3-4,7H,2,5-6H2,1H3,(H4,13,14,15);1H |
| InChIKey | AWGCCAANJAONFK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.63 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|