C16H26ClN3O2 — CID 109467901
1-[2-(5-chloro-2-ethoxyphenyl)ethyl]-2-(3-ethoxypropyl)guanidine (PubChem CID 109467901) has the molecular formula C16H26ClN3O2 and a molecular weight of 327.86 g/mol. Its IUPAC name is 1-[2-(5-chloro-2-ethoxyphenyl)ethyl]-2-(3-ethoxypropyl)guanidine.
| Compound Name | 1-[2-(5-chloro-2-ethoxyphenyl)ethyl]-2-(3-ethoxypropyl)guanidine |
|---|---|
| PubChem CID | 109467901 |
| Molecular Formula | C16H26ClN3O2 |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 1-[2-(5-chloro-2-ethoxyphenyl)ethyl]-2-(3-ethoxypropyl)guanidine |
| SMILES | CCOCCC/N=C(\N)NCCc1cc(Cl)ccc1OCC |
| InChI | InChI=1S/C16H26ClN3O2/c1-3-21-11-5-9-19-16(18)20-10-8-13-12-14(17)6-7-15(13)22-4-2/h6-7,12H,3-5,8-11H2,1-2H3,(H3,18,19,20) |
| InChIKey | YQFOGBUPIOVYLY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|