C13H19BrN4O2 — CID 138995545
4-bromo-N-[2-[[N'-(2-methoxyethyl)carbamimidoyl]amino]ethyl]benzamide (PubChem CID 138995545) has the molecular formula C13H19BrN4O2 and a molecular weight of 343.23 g/mol. Its IUPAC name is 4-bromo-N-[2-[[N'-(2-methoxyethyl)carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | 4-bromo-N-[2-[[N'-(2-methoxyethyl)carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 138995545 |
| Molecular Formula | C13H19BrN4O2 |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 4-bromo-N-[2-[[N'-(2-methoxyethyl)carbamimidoyl]amino]ethyl]benzamide |
| SMILES | COCC/N=C(\N)NCCNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H19BrN4O2/c1-20-9-8-18-13(15)17-7-6-16-12(19)10-2-4-11(14)5-3-10/h2-5H,6-9H2,1H3,(H,16,19)(H3,15,17,18) |
| InChIKey | LAEAUHHGJRMALW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|