C18H22BrN5O — CID 111094025
N-[3-[[amino-(2-pyridin-2-ylethylamino)methylidene]amino]propyl]-4-bromobenzamide (PubChem CID 111094025) has the molecular formula C18H22BrN5O and a molecular weight of 404.31 g/mol. Its IUPAC name is N-[3-[[amino-(2-pyridin-2-ylethylamino)methylidene]amino]propyl]-4-bromobenzamide.
| Compound Name | N-[3-[[amino-(2-pyridin-2-ylethylamino)methylidene]amino]propyl]-4-bromobenzamide |
|---|---|
| PubChem CID | 111094025 |
| Molecular Formula | C18H22BrN5O |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | N-[3-[[amino-(2-pyridin-2-ylethylamino)methylidene]amino]propyl]-4-bromobenzamide |
| SMILES | N/C(=N\CCCNC(=O)c1ccc(Br)cc1)NCCc1ccccn1 |
| InChI | InChI=1S/C18H22BrN5O/c19-15-7-5-14(6-8-15)17(25)22-11-3-12-23-18(20)24-13-9-16-4-1-2-10-21-16/h1-2,4-8,10H,3,9,11-13H2,(H,22,25)(H3,20,23,24) |
| InChIKey | UPGBLTISAQZFCQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|