C18H22BrN5O — CID 110969744
4-bromo-N-[3-[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]propyl]benzamide (PubChem CID 110969744) has the molecular formula C18H22BrN5O and a molecular weight of 404.31 g/mol. Its IUPAC name is 4-bromo-N-[3-[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]propyl]benzamide.
| Compound Name | 4-bromo-N-[3-[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]propyl]benzamide |
|---|---|
| PubChem CID | 110969744 |
| Molecular Formula | C18H22BrN5O |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 4-bromo-N-[3-[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]propyl]benzamide |
| SMILES | C/N=C(/NCCCNC(=O)c1ccc(Br)cc1)NCc1ccccn1 |
| InChI | InChI=1S/C18H22BrN5O/c1-20-18(24-13-16-5-2-3-10-21-16)23-12-4-11-22-17(25)14-6-8-15(19)9-7-14/h2-3,5-10H,4,11-13H2,1H3,(H,22,25)(H2,20,23,24) |
| InChIKey | CIROOLVROADDAG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|