C19H24FIN4O — CID 111043687
N-[2-[[amino-(3-ethylanilino)methylidene]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide (PubChem CID 111043687) has the molecular formula C19H24FIN4O and a molecular weight of 470.33 g/mol. Its IUPAC name is N-[2-[[amino-(3-ethylanilino)methylidene]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide.
| Compound Name | N-[2-[[amino-(3-ethylanilino)methylidene]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111043687 |
| Molecular Formula | C19H24FIN4O |
| Molecular Weight | 470.33 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | N-[2-[[amino-(3-ethylanilino)methylidene]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide |
| SMILES | CCc1cccc(N/C(N)=N/CCNC(=O)c2ccc(C)c(F)c2)c1.I |
| InChI | InChI=1S/C19H23FN4O.HI/c1-3-14-5-4-6-16(11-14)24-19(21)23-10-9-22-18(25)15-8-7-13(2)17(20)12-15;/h4-8,11-12H,3,9-10H2,1-2H3,(H,22,25)(H3,21,23,24);1H |
| InChIKey | PXSGMMPRKGWDCU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|