C21H25FN4O — CID 111720905
N-[2-[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]ethyl]-3-fluoro-4-methylbenzamide (PubChem CID 111720905) has the molecular formula C21H25FN4O and a molecular weight of 368.46 g/mol. Its IUPAC name is N-[2-[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]ethyl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[2-[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]ethyl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 111720905 |
| Molecular Formula | C21H25FN4O |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | N-[2-[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]ethyl]-3-fluoro-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCC/N=C(\N)Nc2cccc3c2CCCC3)cc1F |
| InChI | InChI=1S/C21H25FN4O/c1-14-9-10-16(13-18(14)22)20(27)24-11-12-25-21(23)26-19-8-4-6-15-5-2-3-7-17(15)19/h4,6,8-10,13H,2-3,5,7,11-12H2,1H3,(H,24,27)(H3,23,25,26) |
| InChIKey | PWZOQQNDOVLQQA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|