C18H23IN4O2 — CID 111720888
N-[2-[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]ethyl]furan-2-carboxamide;hydroiodide (PubChem CID 111720888) has the molecular formula C18H23IN4O2 and a molecular weight of 454.31 g/mol. Its IUPAC name is N-[2-[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]ethyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[2-[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]ethyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111720888 |
| Molecular Formula | C18H23IN4O2 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | N-[2-[[amino-(5,6,7,8-tetrahydronaphthalen-1-ylamino)methylidene]amino]ethyl]furan-2-carboxamide;hydroiodide |
| SMILES | I.N/C(=N\CCNC(=O)c1ccco1)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C18H22N4O2.HI/c19-18(21-11-10-20-17(23)16-9-4-12-24-16)22-15-8-3-6-13-5-1-2-7-14(13)15;/h3-4,6,8-9,12H,1-2,5,7,10-11H2,(H,20,23)(H3,19,21,22);1H |
| InChIKey | DBAOWRWFGNYHHS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|