C16H21IN4O2 — CID 111042802
N-[2-[[amino-(4-ethylanilino)methylidene]amino]ethyl]furan-2-carboxamide;hydroiodide (PubChem CID 111042802) has the molecular formula C16H21IN4O2 and a molecular weight of 428.27 g/mol. Its IUPAC name is N-[2-[[amino-(4-ethylanilino)methylidene]amino]ethyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[2-[[amino-(4-ethylanilino)methylidene]amino]ethyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111042802 |
| Molecular Formula | C16H21IN4O2 |
| Molecular Weight | 428.27 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | N-[2-[[amino-(4-ethylanilino)methylidene]amino]ethyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCc1ccc(N/C(N)=N/CCNC(=O)c2ccco2)cc1.I |
| InChI | InChI=1S/C16H20N4O2.HI/c1-2-12-5-7-13(8-6-12)20-16(17)19-10-9-18-15(21)14-4-3-11-22-14;/h3-8,11H,2,9-10H2,1H3,(H,18,21)(H3,17,19,20);1H |
| InChIKey | QNYBTBFECNWCRI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|