C16H20N4O2 — CID 111042777
N-[2-[[amino-(3,5-dimethylanilino)methylidene]amino]ethyl]furan-2-carboxamide (PubChem CID 111042777) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is N-[2-[[amino-(3,5-dimethylanilino)methylidene]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[amino-(3,5-dimethylanilino)methylidene]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111042777 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-[2-[[amino-(3,5-dimethylanilino)methylidene]amino]ethyl]furan-2-carboxamide |
| SMILES | Cc1cc(C)cc(N/C(N)=N/CCNC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C16H20N4O2/c1-11-8-12(2)10-13(9-11)20-16(17)19-6-5-18-15(21)14-4-3-7-22-14/h3-4,7-10H,5-6H2,1-2H3,(H,18,21)(H3,17,19,20) |
| InChIKey | WTUQRYFDZZQENS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|