C18H24N4O2 — CID 111817790
N-[3-[[amino-(3,5-dimethylanilino)methylidene]amino]propyl]-3-methylfuran-2-carboxamide (PubChem CID 111817790) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is N-[3-[[amino-(3,5-dimethylanilino)methylidene]amino]propyl]-3-methylfuran-2-carboxamide.
| Compound Name | N-[3-[[amino-(3,5-dimethylanilino)methylidene]amino]propyl]-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 111817790 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | N-[3-[[amino-(3,5-dimethylanilino)methylidene]amino]propyl]-3-methylfuran-2-carboxamide |
| SMILES | Cc1cc(C)cc(N/C(N)=N/CCCNC(=O)c2occc2C)c1 |
| InChI | InChI=1S/C18H24N4O2/c1-12-9-13(2)11-15(10-12)22-18(19)21-7-4-6-20-17(23)16-14(3)5-8-24-16/h5,8-11H,4,6-7H2,1-3H3,(H,20,23)(H3,19,21,22) |
| InChIKey | FCHHEVGUYAFATE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|