C18H24N4O2 — CID 111042765
N-[2-[[amino-(4-butan-2-ylanilino)methylidene]amino]ethyl]furan-2-carboxamide (PubChem CID 111042765) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is N-[2-[[amino-(4-butan-2-ylanilino)methylidene]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[amino-(4-butan-2-ylanilino)methylidene]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111042765 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | N-[2-[[amino-(4-butan-2-ylanilino)methylidene]amino]ethyl]furan-2-carboxamide |
| SMILES | CCC(C)c1ccc(N/C(N)=N/CCNC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C18H24N4O2/c1-3-13(2)14-6-8-15(9-7-14)22-18(19)21-11-10-20-17(23)16-5-4-12-24-16/h4-9,12-13H,3,10-11H2,1-2H3,(H,20,23)(H3,19,21,22) |
| InChIKey | XWZMNXAJLOGANY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|