C15H19IN4O3 — CID 111042762
N-[2-[[amino-(4-methoxyanilino)methylidene]amino]ethyl]furan-2-carboxamide;hydroiodide (PubChem CID 111042762) has the molecular formula C15H19IN4O3 and a molecular weight of 430.25 g/mol. Its IUPAC name is N-[2-[[amino-(4-methoxyanilino)methylidene]amino]ethyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[2-[[amino-(4-methoxyanilino)methylidene]amino]ethyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111042762 |
| Molecular Formula | C15H19IN4O3 |
| Molecular Weight | 430.25 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | N-[2-[[amino-(4-methoxyanilino)methylidene]amino]ethyl]furan-2-carboxamide;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CCNC(=O)c2ccco2)cc1.I |
| InChI | InChI=1S/C15H18N4O3.HI/c1-21-12-6-4-11(5-7-12)19-15(16)18-9-8-17-14(20)13-3-2-10-22-13;/h2-7,10H,8-9H2,1H3,(H,17,20)(H3,16,18,19);1H |
| InChIKey | AKDVKBHSBURRHA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|