C24H25N3O6 — CID 121062881
N-[2-[[4-[2-(4-methoxyphenoxy)propanoylamino]benzoyl]amino]ethyl]furan-2-carboxamide (PubChem CID 121062881) has the molecular formula C24H25N3O6 and a molecular weight of 451.48 g/mol. Its IUPAC name is N-[2-[[4-[2-(4-methoxyphenoxy)propanoylamino]benzoyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[4-[2-(4-methoxyphenoxy)propanoylamino]benzoyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 121062881 |
| Molecular Formula | C24H25N3O6 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | N-[2-[[4-[2-(4-methoxyphenoxy)propanoylamino]benzoyl]amino]ethyl]furan-2-carboxamide |
| SMILES | COc1ccc(OC(C)C(=O)Nc2ccc(C(=O)NCCNC(=O)c3ccco3)cc2)cc1 |
| InChI | InChI=1S/C24H25N3O6/c1-16(33-20-11-9-19(31-2)10-12-20)22(28)27-18-7-5-17(6-8-18)23(29)25-13-14-26-24(30)21-4-3-15-32-21/h3-12,15-16H,13-14H2,1-2H3,(H,25,29)(H,26,30)(H,27,28) |
| InChIKey | DPHASQRLQADPIG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 118.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|