C23H21Cl2N3O5 — CID 121062746
N-[2-[[4-[2-(2,4-dichlorophenoxy)propanoylamino]benzoyl]amino]ethyl]furan-2-carboxamide (PubChem CID 121062746) has the molecular formula C23H21Cl2N3O5 and a molecular weight of 490.34 g/mol. Its IUPAC name is N-[2-[[4-[2-(2,4-dichlorophenoxy)propanoylamino]benzoyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[4-[2-(2,4-dichlorophenoxy)propanoylamino]benzoyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 121062746 |
| Molecular Formula | C23H21Cl2N3O5 |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | N-[2-[[4-[2-(2,4-dichlorophenoxy)propanoylamino]benzoyl]amino]ethyl]furan-2-carboxamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)Nc1ccc(C(=O)NCCNC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C23H21Cl2N3O5/c1-14(33-19-9-6-16(24)13-18(19)25)21(29)28-17-7-4-15(5-8-17)22(30)26-10-11-27-23(31)20-3-2-12-32-20/h2-9,12-14H,10-11H2,1H3,(H,26,30)(H,27,31)(H,28,29) |
| InChIKey | NIHPFTWWDHSZFV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|