C9H15IN4O2 — CID 110914716
N-[2-[(N'-methylcarbamimidoyl)amino]ethyl]furan-2-carboxamide;hydroiodide (PubChem CID 110914716) has the molecular formula C9H15IN4O2 and a molecular weight of 338.15 g/mol. Its IUPAC name is N-[2-[(N'-methylcarbamimidoyl)amino]ethyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[2-[(N'-methylcarbamimidoyl)amino]ethyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 110914716 |
| Molecular Formula | C9H15IN4O2 |
| Molecular Weight | 338.15 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | N-[2-[(N'-methylcarbamimidoyl)amino]ethyl]furan-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\N)NCCNC(=O)c1ccco1.I |
| InChI | InChI=1S/C9H14N4O2.HI/c1-11-9(10)13-5-4-12-8(14)7-3-2-6-15-7;/h2-3,6H,4-5H2,1H3,(H,12,14)(H3,10,11,13);1H |
| InChIKey | OYNMICGLTYKXGK-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.15 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|