C18H30N4O — CID 111094948
N-[2-[[amino-(4-butan-2-ylanilino)methylidene]amino]ethyl]-2,2-dimethylpropanamide (PubChem CID 111094948) has the molecular formula C18H30N4O and a molecular weight of 318.47 g/mol. Its IUPAC name is N-[2-[[amino-(4-butan-2-ylanilino)methylidene]amino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[[amino-(4-butan-2-ylanilino)methylidene]amino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 111094948 |
| Molecular Formula | C18H30N4O |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | N-[2-[[amino-(4-butan-2-ylanilino)methylidene]amino]ethyl]-2,2-dimethylpropanamide |
| SMILES | CCC(C)c1ccc(N/C(N)=N/CCNC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H30N4O/c1-6-13(2)14-7-9-15(10-8-14)22-17(19)21-12-11-20-16(23)18(3,4)5/h7-10,13H,6,11-12H2,1-5H3,(H,20,23)(H3,19,21,22) |
| InChIKey | VUBLVBCUEWLTSB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|