C18H24F3IN6 — CID 111800929
1-(4-butan-2-ylphenyl)-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide (PubChem CID 111800929) has the molecular formula C18H24F3IN6 and a molecular weight of 508.33 g/mol. Its IUPAC name is 1-(4-butan-2-ylphenyl)-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-(4-butan-2-ylphenyl)-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111800929 |
| Molecular Formula | C18H24F3IN6 |
| Molecular Weight | 508.33 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 1-(4-butan-2-ylphenyl)-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine;hydroiodide |
| SMILES | CCC(C)c1ccc(N/C(N)=N/CCNc2nccc(C(F)(F)F)n2)cc1.I |
| InChI | InChI=1S/C18H23F3N6.HI/c1-3-12(2)13-4-6-14(7-5-13)26-16(22)23-10-11-25-17-24-9-8-15(27-17)18(19,20)21;/h4-9,12H,3,10-11H2,1-2H3,(H3,22,23,26)(H,24,25,27);1H |
| InChIKey | QPTSCTJVYZRSQG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|