C16H17Cl2F3N6 — CID 111800912
1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine (PubChem CID 111800912) has the molecular formula C16H17Cl2F3N6 and a molecular weight of 421.25 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111800912 |
| Molecular Formula | C16H17Cl2F3N6 |
| Molecular Weight | 421.25 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine |
| SMILES | CC(N/C(N)=N/CCNc1nccc(C(F)(F)F)n1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H17Cl2F3N6/c1-9(11-3-2-10(17)8-12(11)18)26-14(22)23-6-7-25-15-24-5-4-13(27-15)16(19,20)21/h2-5,8-9H,6-7H2,1H3,(H3,22,23,26)(H,24,25,27) |
| InChIKey | JTCHXXPKIMLFNG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.25 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|