C17H21F3N6 — CID 111800872
1-(3-propan-2-ylphenyl)-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine (PubChem CID 111800872) has the molecular formula C17H21F3N6 and a molecular weight of 366.39 g/mol. Its IUPAC name is 1-(3-propan-2-ylphenyl)-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine.
| Compound Name | 1-(3-propan-2-ylphenyl)-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 111800872 |
| Molecular Formula | C17H21F3N6 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 1-(3-propan-2-ylphenyl)-2-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]guanidine |
| SMILES | CC(C)c1cccc(N/C(N)=N/CCNc2nccc(C(F)(F)F)n2)c1 |
| InChI | InChI=1S/C17H21F3N6/c1-11(2)12-4-3-5-13(10-12)25-15(21)22-8-9-24-16-23-7-6-14(26-16)17(18,19)20/h3-7,10-11H,8-9H2,1-2H3,(H3,21,22,25)(H,23,24,26) |
| InChIKey | HEATWIAWJDINQT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|