C18H25F3IN5O — CID 111046696
1-(3-propan-2-ylphenyl)-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide (PubChem CID 111046696) has the molecular formula C18H25F3IN5O and a molecular weight of 511.33 g/mol. Its IUPAC name is 1-(3-propan-2-ylphenyl)-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide.
| Compound Name | 1-(3-propan-2-ylphenyl)-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111046696 |
| Molecular Formula | C18H25F3IN5O |
| Molecular Weight | 511.33 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | 1-(3-propan-2-ylphenyl)-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
| SMILES | CC(C)c1cccc(N/C(N)=N/CCC(O)(c2nccn2C)C(F)(F)F)c1.I |
| InChI | InChI=1S/C18H24F3N5O.HI/c1-12(2)13-5-4-6-14(11-13)25-16(22)24-8-7-17(27,18(19,20)21)15-23-9-10-26(15)3;/h4-6,9-12,27H,7-8H2,1-3H3,(H3,22,24,25);1H |
| InChIKey | QIPAULHSKBTLLP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|