C16H21F3IN5O — CID 111046674
1-(4-methylphenyl)-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide (PubChem CID 111046674) has the molecular formula C16H21F3IN5O and a molecular weight of 483.28 g/mol. Its IUPAC name is 1-(4-methylphenyl)-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide.
| Compound Name | 1-(4-methylphenyl)-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111046674 |
| Molecular Formula | C16H21F3IN5O |
| Molecular Weight | 483.28 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | 1-(4-methylphenyl)-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
| SMILES | Cc1ccc(N/C(N)=N/CCC(O)(c2nccn2C)C(F)(F)F)cc1.I |
| InChI | InChI=1S/C16H20F3N5O.HI/c1-11-3-5-12(6-4-11)23-14(20)22-8-7-15(25,16(17,18)19)13-21-9-10-24(13)2;/h3-6,9-10,25H,7-8H2,1-2H3,(H3,20,22,23);1H |
| InChIKey | LZIVHWXNPAGLFW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|