C20H29F3IN5O — CID 111287646
3-ethyl-1-methyl-1-[(2-methylphenyl)methyl]-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide (PubChem CID 111287646) has the molecular formula C20H29F3IN5O and a molecular weight of 539.38 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-[(2-methylphenyl)methyl]-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-1-[(2-methylphenyl)methyl]-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111287646 |
| Molecular Formula | C20H29F3IN5O |
| Molecular Weight | 539.38 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | 3-ethyl-1-methyl-1-[(2-methylphenyl)methyl]-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCC(O)(c1nccn1C)C(F)(F)F)N(C)Cc1ccccc1C.I |
| InChI | InChI=1S/C20H28F3N5O.HI/c1-5-24-18(28(4)14-16-9-7-6-8-15(16)2)26-11-10-19(29,20(21,22)23)17-25-12-13-27(17)3;/h6-9,12-13,29H,5,10-11,14H2,1-4H3,(H,24,26);1H |
| InChIKey | JGAWWAMHZNILRN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|