C17H26F3IN6OS — CID 109424751
3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide (PubChem CID 109424751) has the molecular formula C17H26F3IN6OS and a molecular weight of 546.40 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109424751 |
| Molecular Formula | C17H26F3IN6OS |
| Molecular Weight | 546.40 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | 3-ethyl-1-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCC(O)(c1nccn1C)C(F)(F)F)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C17H25F3N6OS.HI/c1-5-21-15(26(4)10-13-11-28-12(2)24-13)23-7-6-16(27,17(18,19)20)14-22-8-9-25(14)3;/h8-9,11,27H,5-7,10H2,1-4H3,(H,21,23);1H |
| InChIKey | LLCYZBGCKRHAHH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 78.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|