C19H25F4N5O — CID 111286495
3-ethyl-1-[(3-fluorophenyl)methyl]-1-methyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine (PubChem CID 111286495) has the molecular formula C19H25F4N5O and a molecular weight of 415.44 g/mol. Its IUPAC name is 3-ethyl-1-[(3-fluorophenyl)methyl]-1-methyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine.
| Compound Name | 3-ethyl-1-[(3-fluorophenyl)methyl]-1-methyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine |
|---|---|
| PubChem CID | 111286495 |
| Molecular Formula | C19H25F4N5O |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 3-ethyl-1-[(3-fluorophenyl)methyl]-1-methyl-2-[4,4,4-trifluoro-3-hydroxy-3-(1-methylimidazol-2-yl)butyl]guanidine |
| SMILES | CCN/C(=N\CCC(O)(c1nccn1C)C(F)(F)F)N(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C19H25F4N5O/c1-4-24-17(28(3)13-14-6-5-7-15(20)12-14)26-9-8-18(29,19(21,22)23)16-25-10-11-27(16)2/h5-7,10-12,29H,4,8-9,13H2,1-3H3,(H,24,26) |
| InChIKey | HLMNAGCIYGMITF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|