C16H20F3N5 — CID 111285481
2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-ethyl-1-[(3-fluorophenyl)methyl]-1-methylguanidine (PubChem CID 111285481) has the molecular formula C16H20F3N5 and a molecular weight of 339.37 g/mol. Its IUPAC name is 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-ethyl-1-[(3-fluorophenyl)methyl]-1-methylguanidine.
| Compound Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-ethyl-1-[(3-fluorophenyl)methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 111285481 |
| Molecular Formula | C16H20F3N5 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-ethyl-1-[(3-fluorophenyl)methyl]-1-methylguanidine |
| SMILES | CCN/C(=N\Cc1nccn1C(F)F)N(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C16H20F3N5/c1-3-20-16(22-10-14-21-7-8-24(14)15(18)19)23(2)11-12-5-4-6-13(17)9-12/h4-9,15H,3,10-11H2,1-2H3,(H,20,22) |
| InChIKey | PTMURPQESJSBCC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|