C15H25FIN3 — CID 111286076
3-ethyl-1-[(3-fluorophenyl)methyl]-1-methyl-2-(2-methylpropyl)guanidine;hydroiodide (PubChem CID 111286076) has the molecular formula C15H25FIN3 and a molecular weight of 393.29 g/mol. Its IUPAC name is 3-ethyl-1-[(3-fluorophenyl)methyl]-1-methyl-2-(2-methylpropyl)guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-[(3-fluorophenyl)methyl]-1-methyl-2-(2-methylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111286076 |
| Molecular Formula | C15H25FIN3 |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 3-ethyl-1-[(3-fluorophenyl)methyl]-1-methyl-2-(2-methylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)C)N(C)Cc1cccc(F)c1.I |
| InChI | InChI=1S/C15H24FN3.HI/c1-5-17-15(18-10-12(2)3)19(4)11-13-7-6-8-14(16)9-13;/h6-9,12H,5,10-11H2,1-4H3,(H,17,18);1H |
| InChIKey | WCCYPBRRQOQPMC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|